C9H15N7 — CID 135043247
4-N-(2-aminoethyl)-6-N-methyl-2-N-prop-2-ynyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 135043247) has the molecular formula C9H15N7 and a molecular weight of 221.27 g/mol. Its IUPAC name is 4-N-(2-aminoethyl)-6-N-methyl-2-N-prop-2-ynyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-(2-aminoethyl)-6-N-methyl-2-N-prop-2-ynyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 135043247 |
| Molecular Formula | C9H15N7 |
| Molecular Weight | 221.27 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 4-N-(2-aminoethyl)-6-N-methyl-2-N-prop-2-ynyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | C#CCNc1nc(NC)nc(NCCN)n1 |
| InChI | InChI=1S/C9H15N7/c1-3-5-12-8-14-7(11-2)15-9(16-8)13-6-4-10/h1H,4-6,10H2,2H3,(H3,11,12,13,14,15,16) |
| InChIKey | UYPTUMKCDSORGD-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.27 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|