C6H6ClN5 — CID 118444193
6-chloro-2-N-prop-2-ynyl-1,3,5-triazine-2,4-diamine (PubChem CID 118444193) has the molecular formula C6H6ClN5 and a molecular weight of 183.60 g/mol. Its IUPAC name is 6-chloro-2-N-prop-2-ynyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N-prop-2-ynyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 118444193 |
| Molecular Formula | C6H6ClN5 |
| Molecular Weight | 183.60 g/mol |
| Exact Mass | 183.03 |
| IUPAC Name | 6-chloro-2-N-prop-2-ynyl-1,3,5-triazine-2,4-diamine |
| SMILES | C#CCNc1nc(N)nc(Cl)n1 |
| InChI | InChI=1S/C6H6ClN5/c1-2-3-9-6-11-4(7)10-5(8)12-6/h1H,3H2,(H3,8,9,10,11,12) |
| InChIKey | WMKAGIHKIPLEHI-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.60 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|