C7H12ClN5O2 — CID 122714726
6-chloro-2-N-(2,2-dimethoxyethyl)-1,3,5-triazine-2,4-diamine (PubChem CID 122714726) has the molecular formula C7H12ClN5O2 and a molecular weight of 233.66 g/mol. Its IUPAC name is 6-chloro-2-N-(2,2-dimethoxyethyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-2-N-(2,2-dimethoxyethyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 122714726 |
| Molecular Formula | C7H12ClN5O2 |
| Molecular Weight | 233.66 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 6-chloro-2-N-(2,2-dimethoxyethyl)-1,3,5-triazine-2,4-diamine |
| SMILES | COC(CNc1nc(N)nc(Cl)n1)OC |
| InChI | InChI=1S/C7H12ClN5O2/c1-14-4(15-2)3-10-7-12-5(8)11-6(9)13-7/h4H,3H2,1-2H3,(H3,9,10,11,12,13) |
| InChIKey | UZNHMZURVJNIPU-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.66 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|