C9H15N7 — CID 123592748
2-[[4-(methylamino)-6-(propylamino)-1,3,5-triazin-2-yl]amino]acetonitrile (PubChem CID 123592748) has the molecular formula C9H15N7 and a molecular weight of 221.27 g/mol. Its IUPAC name is 2-[[4-(methylamino)-6-(propylamino)-1,3,5-triazin-2-yl]amino]acetonitrile.
| Compound Name | 2-[[4-(methylamino)-6-(propylamino)-1,3,5-triazin-2-yl]amino]acetonitrile |
|---|---|
| PubChem CID | 123592748 |
| Molecular Formula | C9H15N7 |
| Molecular Weight | 221.27 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 2-[[4-(methylamino)-6-(propylamino)-1,3,5-triazin-2-yl]amino]acetonitrile |
| SMILES | CCCNc1nc(NC)nc(NCC#N)n1 |
| InChI | InChI=1S/C9H15N7/c1-3-5-12-8-14-7(11-2)15-9(16-8)13-6-4-10/h3,5-6H2,1-2H3,(H3,11,12,13,14,15,16) |
| InChIKey | ZIUGCNOYMWDSOR-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 98.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.27 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|