C27H34N6O2 — CID 69336278
8-(furan-2-yl)-2-(3-phenylpropoxy)-9-(4-piperidin-1-ylbutyl)purin-6-amine (PubChem CID 69336278) has the molecular formula C27H34N6O2 and a molecular weight of 474.61 g/mol. Its IUPAC name is 8-(furan-2-yl)-2-(3-phenylpropoxy)-9-(4-piperidin-1-ylbutyl)purin-6-amine.
| Compound Name | 8-(furan-2-yl)-2-(3-phenylpropoxy)-9-(4-piperidin-1-ylbutyl)purin-6-amine |
|---|---|
| PubChem CID | 69336278 |
| Molecular Formula | C27H34N6O2 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.27 |
| IUPAC Name | 8-(furan-2-yl)-2-(3-phenylpropoxy)-9-(4-piperidin-1-ylbutyl)purin-6-amine |
| SMILES | Nc1nc(OCCCc2ccccc2)nc2c1nc(-c1ccco1)n2CCCCN1CCCCC1 |
| InChI | InChI=1S/C27H34N6O2/c28-24-23-26(31-27(30-24)35-20-9-13-21-11-3-1-4-12-21)33(25(29-23)22-14-10-19-34-22)18-8-7-17-32-15-5-2-6-16-32/h1,3-4,10-12,14,19H,2,5-9,13,15-18,20H2,(H2,28,30,31) |
| InChIKey | JFPQXPKDYZGYPR-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 95.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|