C19H26FN7O — CID 67003227
4-[[6-[(2-amino-5-fluorophenyl)methylamino]-9-ethylpurin-2-yl]amino]-2-methylbutan-2-ol (PubChem CID 67003227) has the molecular formula C19H26FN7O and a molecular weight of 387.46 g/mol. Its IUPAC name is 4-[[6-[(2-amino-5-fluorophenyl)methylamino]-9-ethylpurin-2-yl]amino]-2-methylbutan-2-ol.
| Compound Name | 4-[[6-[(2-amino-5-fluorophenyl)methylamino]-9-ethylpurin-2-yl]amino]-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 67003227 |
| Molecular Formula | C19H26FN7O |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 4-[[6-[(2-amino-5-fluorophenyl)methylamino]-9-ethylpurin-2-yl]amino]-2-methylbutan-2-ol |
| SMILES | CCn1cnc2c(NCc3cc(F)ccc3N)nc(NCCC(C)(C)O)nc21 |
| InChI | InChI=1S/C19H26FN7O/c1-4-27-11-24-15-16(23-10-12-9-13(20)5-6-14(12)21)25-18(26-17(15)27)22-8-7-19(2,3)28/h5-6,9,11,28H,4,7-8,10,21H2,1-3H3,(H2,22,23,25,26) |
| InChIKey | JDGYMEHPDOQKRJ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 113.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|