C21H31N7O2 — CID 67002141
4-[[6-[(2-amino-3-methoxyphenyl)methylamino]-9-ethylpurin-2-yl]amino]-2,3-dimethylbutan-2-ol (PubChem CID 67002141) has the molecular formula C21H31N7O2 and a molecular weight of 413.53 g/mol. Its IUPAC name is 4-[[6-[(2-amino-3-methoxyphenyl)methylamino]-9-ethylpurin-2-yl]amino]-2,3-dimethylbutan-2-ol.
| Compound Name | 4-[[6-[(2-amino-3-methoxyphenyl)methylamino]-9-ethylpurin-2-yl]amino]-2,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 67002141 |
| Molecular Formula | C21H31N7O2 |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.25 |
| IUPAC Name | 4-[[6-[(2-amino-3-methoxyphenyl)methylamino]-9-ethylpurin-2-yl]amino]-2,3-dimethylbutan-2-ol |
| SMILES | CCn1cnc2c(NCc3cccc(OC)c3N)nc(NCC(C)C(C)(C)O)nc21 |
| InChI | InChI=1S/C21H31N7O2/c1-6-28-12-25-17-18(23-11-14-8-7-9-15(30-5)16(14)22)26-20(27-19(17)28)24-10-13(2)21(3,4)29/h7-9,12-13,29H,6,10-11,22H2,1-5H3,(H2,23,24,26,27) |
| InChIKey | YZEWNURVWYBTEU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 123.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|