C25H30IN7O — CID 67002615
3-[[6-[(2-amino-5-iodophenyl)methylamino]-9-benzylpurin-2-yl]amino]-2-methylpentan-2-ol (PubChem CID 67002615) has the molecular formula C25H30IN7O and a molecular weight of 571.47 g/mol. Its IUPAC name is 3-[[6-[(2-amino-5-iodophenyl)methylamino]-9-benzylpurin-2-yl]amino]-2-methylpentan-2-ol.
| Compound Name | 3-[[6-[(2-amino-5-iodophenyl)methylamino]-9-benzylpurin-2-yl]amino]-2-methylpentan-2-ol |
|---|---|
| PubChem CID | 67002615 |
| Molecular Formula | C25H30IN7O |
| Molecular Weight | 571.47 g/mol |
| Exact Mass | 571.16 |
| IUPAC Name | 3-[[6-[(2-amino-5-iodophenyl)methylamino]-9-benzylpurin-2-yl]amino]-2-methylpentan-2-ol |
| SMILES | CCC(Nc1nc(NCc2cc(I)ccc2N)c2ncn(Cc3ccccc3)c2n1)C(C)(C)O |
| InChI | InChI=1S/C25H30IN7O/c1-4-20(25(2,3)34)30-24-31-22(28-13-17-12-18(26)10-11-19(17)27)21-23(32-24)33(15-29-21)14-16-8-6-5-7-9-16/h5-12,15,20,34H,4,13-14,27H2,1-3H3,(H2,28,30,31,32) |
| InChIKey | YTAANWPHNDAZQW-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 113.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.47 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|