C19H26ClN7O — CID 67002003
3-[[6-[(2-amino-5-chlorophenyl)methylamino]-9-methylpurin-2-yl]amino]-2-methylpentan-2-ol (PubChem CID 67002003) has the molecular formula C19H26ClN7O and a molecular weight of 403.92 g/mol. Its IUPAC name is 3-[[6-[(2-amino-5-chlorophenyl)methylamino]-9-methylpurin-2-yl]amino]-2-methylpentan-2-ol.
| Compound Name | 3-[[6-[(2-amino-5-chlorophenyl)methylamino]-9-methylpurin-2-yl]amino]-2-methylpentan-2-ol |
|---|---|
| PubChem CID | 67002003 |
| Molecular Formula | C19H26ClN7O |
| Molecular Weight | 403.92 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 3-[[6-[(2-amino-5-chlorophenyl)methylamino]-9-methylpurin-2-yl]amino]-2-methylpentan-2-ol |
| SMILES | CCC(Nc1nc(NCc2cc(Cl)ccc2N)c2ncn(C)c2n1)C(C)(C)O |
| InChI | InChI=1S/C19H26ClN7O/c1-5-14(19(2,3)28)24-18-25-16(15-17(26-18)27(4)10-23-15)22-9-11-8-12(20)6-7-13(11)21/h6-8,10,14,28H,5,9,21H2,1-4H3,(H2,22,24,25,26) |
| InChIKey | KFRRPKAWEJFCPL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 113.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.92 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|