C18H24N6O2S — CID 66799445
2-[[[2-(2-hydroxypentan-3-ylamino)-9-methylpurin-6-yl]amino]methyl]-4-sulfanylphenol (PubChem CID 66799445) has the molecular formula C18H24N6O2S and a molecular weight of 388.50 g/mol. Its IUPAC name is 2-[[[2-(2-hydroxypentan-3-ylamino)-9-methylpurin-6-yl]amino]methyl]-4-sulfanylphenol.
| Compound Name | 2-[[[2-(2-hydroxypentan-3-ylamino)-9-methylpurin-6-yl]amino]methyl]-4-sulfanylphenol |
|---|---|
| PubChem CID | 66799445 |
| Molecular Formula | C18H24N6O2S |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 2-[[[2-(2-hydroxypentan-3-ylamino)-9-methylpurin-6-yl]amino]methyl]-4-sulfanylphenol |
| SMILES | CCC(Nc1nc(NCc2cc(S)ccc2O)c2ncn(C)c2n1)C(C)O |
| InChI | InChI=1S/C18H24N6O2S/c1-4-13(10(2)25)21-18-22-16(15-17(23-18)24(3)9-20-15)19-8-11-7-12(27)5-6-14(11)26/h5-7,9-10,13,25-27H,4,8H2,1-3H3,(H2,19,21,22,23) |
| InChIKey | PEVNFTBXWRWPIQ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 108.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|