C19H27N7O2 — CID 67003069
3-[[6-[(2-amino-5-methoxyphenyl)methylamino]-9-methylpurin-2-yl]amino]pentan-2-ol (PubChem CID 67003069) has the molecular formula C19H27N7O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is 3-[[6-[(2-amino-5-methoxyphenyl)methylamino]-9-methylpurin-2-yl]amino]pentan-2-ol.
| Compound Name | 3-[[6-[(2-amino-5-methoxyphenyl)methylamino]-9-methylpurin-2-yl]amino]pentan-2-ol |
|---|---|
| PubChem CID | 67003069 |
| Molecular Formula | C19H27N7O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | 3-[[6-[(2-amino-5-methoxyphenyl)methylamino]-9-methylpurin-2-yl]amino]pentan-2-ol |
| SMILES | CCC(Nc1nc(NCc2cc(OC)ccc2N)c2ncn(C)c2n1)C(C)O |
| InChI | InChI=1S/C19H27N7O2/c1-5-15(11(2)27)23-19-24-17(16-18(25-19)26(3)10-22-16)21-9-12-8-13(28-4)6-7-14(12)20/h6-8,10-11,15,27H,5,9,20H2,1-4H3,(H2,21,23,24,25) |
| InChIKey | LJEJWLSUFUWARI-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 123.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|