C24H28ClN7O — CID 67002739
3-[[6-[(2-amino-5-chlorophenyl)methylamino]-9-benzylpurin-2-yl]amino]pentan-2-ol (PubChem CID 67002739) has the molecular formula C24H28ClN7O and a molecular weight of 465.99 g/mol. Its IUPAC name is 3-[[6-[(2-amino-5-chlorophenyl)methylamino]-9-benzylpurin-2-yl]amino]pentan-2-ol.
| Compound Name | 3-[[6-[(2-amino-5-chlorophenyl)methylamino]-9-benzylpurin-2-yl]amino]pentan-2-ol |
|---|---|
| PubChem CID | 67002739 |
| Molecular Formula | C24H28ClN7O |
| Molecular Weight | 465.99 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | 3-[[6-[(2-amino-5-chlorophenyl)methylamino]-9-benzylpurin-2-yl]amino]pentan-2-ol |
| SMILES | CCC(Nc1nc(NCc2cc(Cl)ccc2N)c2ncn(Cc3ccccc3)c2n1)C(C)O |
| InChI | InChI=1S/C24H28ClN7O/c1-3-20(15(2)33)29-24-30-22(27-12-17-11-18(25)9-10-19(17)26)21-23(31-24)32(14-28-21)13-16-7-5-4-6-8-16/h4-11,14-15,20,33H,3,12-13,26H2,1-2H3,(H2,27,29,30,31) |
| InChIKey | MHWXKIGYZQZANW-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 113.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.99 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|