C20H28IN7O — CID 67002936
4-[[6-[(2-amino-5-iodophenyl)methylamino]-9-ethylpurin-2-yl]amino]-2,3-dimethylbutan-2-ol (PubChem CID 67002936) has the molecular formula C20H28IN7O and a molecular weight of 509.40 g/mol. Its IUPAC name is 4-[[6-[(2-amino-5-iodophenyl)methylamino]-9-ethylpurin-2-yl]amino]-2,3-dimethylbutan-2-ol.
| Compound Name | 4-[[6-[(2-amino-5-iodophenyl)methylamino]-9-ethylpurin-2-yl]amino]-2,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 67002936 |
| Molecular Formula | C20H28IN7O |
| Molecular Weight | 509.40 g/mol |
| Exact Mass | 509.14 |
| IUPAC Name | 4-[[6-[(2-amino-5-iodophenyl)methylamino]-9-ethylpurin-2-yl]amino]-2,3-dimethylbutan-2-ol |
| SMILES | CCn1cnc2c(NCc3cc(I)ccc3N)nc(NCC(C)C(C)(C)O)nc21 |
| InChI | InChI=1S/C20H28IN7O/c1-5-28-11-25-16-17(23-10-13-8-14(21)6-7-15(13)22)26-19(27-18(16)28)24-9-12(2)20(3,4)29/h6-8,11-12,29H,5,9-10,22H2,1-4H3,(H2,23,24,26,27) |
| InChIKey | RAIYWJPKQGVGLA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 113.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|