C15H17FN6 — CID 91287110
[9-ethyl-2-[2-(2-fluorophenyl)ethyl]purin-6-yl]hydrazine (PubChem CID 91287110) has the molecular formula C15H17FN6 and a molecular weight of 300.34 g/mol. Its IUPAC name is [9-ethyl-2-[2-(2-fluorophenyl)ethyl]purin-6-yl]hydrazine.
| Compound Name | [9-ethyl-2-[2-(2-fluorophenyl)ethyl]purin-6-yl]hydrazine |
|---|---|
| PubChem CID | 91287110 |
| Molecular Formula | C15H17FN6 |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | [9-ethyl-2-[2-(2-fluorophenyl)ethyl]purin-6-yl]hydrazine |
| SMILES | CCn1cnc2c(NN)nc(CCc3ccccc3F)nc21 |
| InChI | InChI=1S/C15H17FN6/c1-2-22-9-18-13-14(21-17)19-12(20-15(13)22)8-7-10-5-3-4-6-11(10)16/h3-6,9H,2,7-8,17H2,1H3,(H,19,20,21) |
| InChIKey | ITGNATOFEQONKM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|