C13H13FN6S — CID 63221859
[6-[(2-fluorophenyl)sulfanylmethyl]-1-methylpyrazolo[3,4-d]pyrimidin-4-yl]hydrazine (PubChem CID 63221859) has the molecular formula C13H13FN6S and a molecular weight of 304.35 g/mol. Its IUPAC name is [6-[(2-fluorophenyl)sulfanylmethyl]-1-methylpyrazolo[3,4-d]pyrimidin-4-yl]hydrazine.
| Compound Name | [6-[(2-fluorophenyl)sulfanylmethyl]-1-methylpyrazolo[3,4-d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 63221859 |
| Molecular Formula | C13H13FN6S |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | [6-[(2-fluorophenyl)sulfanylmethyl]-1-methylpyrazolo[3,4-d]pyrimidin-4-yl]hydrazine |
| SMILES | Cn1ncc2c(NN)nc(CSc3ccccc3F)nc21 |
| InChI | InChI=1S/C13H13FN6S/c1-20-13-8(6-16-20)12(19-15)17-11(18-13)7-21-10-5-3-2-4-9(10)14/h2-6H,7,15H2,1H3,(H,17,18,19) |
| InChIKey | DVWIXIJOYZFSEU-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|