C9H12F2N6O — CID 82007218
[6-(2,2-difluoroethoxymethyl)-1-methylpyrazolo[3,4-d]pyrimidin-4-yl]hydrazine (PubChem CID 82007218) has the molecular formula C9H12F2N6O and a molecular weight of 258.23 g/mol. Its IUPAC name is [6-(2,2-difluoroethoxymethyl)-1-methylpyrazolo[3,4-d]pyrimidin-4-yl]hydrazine.
| Compound Name | [6-(2,2-difluoroethoxymethyl)-1-methylpyrazolo[3,4-d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 82007218 |
| Molecular Formula | C9H12F2N6O |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | [6-(2,2-difluoroethoxymethyl)-1-methylpyrazolo[3,4-d]pyrimidin-4-yl]hydrazine |
| SMILES | Cn1ncc2c(NN)nc(COCC(F)F)nc21 |
| InChI | InChI=1S/C9H12F2N6O/c1-17-9-5(2-13-17)8(16-12)14-7(15-9)4-18-3-6(10)11/h2,6H,3-4,12H2,1H3,(H,14,15,16) |
| InChIKey | DSRPPFYTHBCUFG-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|