C12H14N8S — CID 63221592
[1-methyl-6-[(4-methylpyrimidin-2-yl)sulfanylmethyl]pyrazolo[3,4-d]pyrimidin-4-yl]hydrazine (PubChem CID 63221592) has the molecular formula C12H14N8S and a molecular weight of 302.37 g/mol. Its IUPAC name is [1-methyl-6-[(4-methylpyrimidin-2-yl)sulfanylmethyl]pyrazolo[3,4-d]pyrimidin-4-yl]hydrazine.
| Compound Name | [1-methyl-6-[(4-methylpyrimidin-2-yl)sulfanylmethyl]pyrazolo[3,4-d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 63221592 |
| Molecular Formula | C12H14N8S |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | [1-methyl-6-[(4-methylpyrimidin-2-yl)sulfanylmethyl]pyrazolo[3,4-d]pyrimidin-4-yl]hydrazine |
| SMILES | Cc1ccnc(SCc2nc(NN)c3cnn(C)c3n2)n1 |
| InChI | InChI=1S/C12H14N8S/c1-7-3-4-14-12(16-7)21-6-9-17-10(19-13)8-5-15-20(2)11(8)18-9/h3-5H,6,13H2,1-2H3,(H,17,18,19) |
| InChIKey | WGMPWEPQVSIUCS-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 107.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|