C20H15ClF2N4O — CID 69078134
1-(4-chlorophenyl)-2-[(2,3-difluorophenyl)methyl]-9-ethylpurin-6-one (PubChem CID 69078134) has the molecular formula C20H15ClF2N4O and a molecular weight of 400.82 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-[(2,3-difluorophenyl)methyl]-9-ethylpurin-6-one.
| Compound Name | 1-(4-chlorophenyl)-2-[(2,3-difluorophenyl)methyl]-9-ethylpurin-6-one |
|---|---|
| PubChem CID | 69078134 |
| Molecular Formula | C20H15ClF2N4O |
| Molecular Weight | 400.82 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 1-(4-chlorophenyl)-2-[(2,3-difluorophenyl)methyl]-9-ethylpurin-6-one |
| SMILES | CCn1cnc2c(=O)n(-c3ccc(Cl)cc3)c(Cc3cccc(F)c3F)nc21 |
| InChI | InChI=1S/C20H15ClF2N4O/c1-2-26-11-24-18-19(26)25-16(10-12-4-3-5-15(22)17(12)23)27(20(18)28)14-8-6-13(21)7-9-14/h3-9,11H,2,10H2,1H3 |
| InChIKey | JQCHQDJOZJBIAW-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.82 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |