C19H15Cl2N5O — CID 86636667
1-(4-chlorophenyl)-2-[(6-chloro-3-pyridinyl)methyl]-9-ethylpurin-6-one (PubChem CID 86636667) has the molecular formula C19H15Cl2N5O and a molecular weight of 400.27 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-[(6-chloro-3-pyridinyl)methyl]-9-ethylpurin-6-one.
| Compound Name | 1-(4-chlorophenyl)-2-[(6-chloro-3-pyridinyl)methyl]-9-ethylpurin-6-one |
|---|---|
| PubChem CID | 86636667 |
| Molecular Formula | C19H15Cl2N5O |
| Molecular Weight | 400.27 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | 1-(4-chlorophenyl)-2-[(6-chloro-3-pyridinyl)methyl]-9-ethylpurin-6-one |
| SMILES | CCn1cnc2c(=O)n(-c3ccc(Cl)cc3)c(Cc3ccc(Cl)nc3)nc21 |
| InChI | InChI=1S/C19H15Cl2N5O/c1-2-25-11-23-17-18(25)24-16(9-12-3-8-15(21)22-10-12)26(19(17)27)14-6-4-13(20)5-7-14/h3-8,10-11H,2,9H2,1H3 |
| InChIKey | RGUVPGPFJFDDPH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.27 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|