C20H14ClF3N4O — CID 69078907
1-(4-chlorophenyl)-9-ethyl-2-[(3,4,5-trifluorophenyl)methyl]purin-6-one (PubChem CID 69078907) has the molecular formula C20H14ClF3N4O and a molecular weight of 418.81 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-9-ethyl-2-[(3,4,5-trifluorophenyl)methyl]purin-6-one.
| Compound Name | 1-(4-chlorophenyl)-9-ethyl-2-[(3,4,5-trifluorophenyl)methyl]purin-6-one |
|---|---|
| PubChem CID | 69078907 |
| Molecular Formula | C20H14ClF3N4O |
| Molecular Weight | 418.81 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | 1-(4-chlorophenyl)-9-ethyl-2-[(3,4,5-trifluorophenyl)methyl]purin-6-one |
| SMILES | CCn1cnc2c(=O)n(-c3ccc(Cl)cc3)c(Cc3cc(F)c(F)c(F)c3)nc21 |
| InChI | InChI=1S/C20H14ClF3N4O/c1-2-27-10-25-18-19(27)26-16(9-11-7-14(22)17(24)15(23)8-11)28(20(18)29)13-5-3-12(21)4-6-13/h3-8,10H,2,9H2,1H3 |
| InChIKey | YFZWGVLLQRZLIB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.81 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|