C18H18ClF3N4O — CID 24891515
1-(4-chlorophenyl)-9-ethyl-2-(4,4,4-trifluoro-3-methylbutyl)purin-6-one (PubChem CID 24891515) has the molecular formula C18H18ClF3N4O and a molecular weight of 398.82 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-9-ethyl-2-(4,4,4-trifluoro-3-methylbutyl)purin-6-one.
| Compound Name | 1-(4-chlorophenyl)-9-ethyl-2-(4,4,4-trifluoro-3-methylbutyl)purin-6-one |
|---|---|
| PubChem CID | 24891515 |
| Molecular Formula | C18H18ClF3N4O |
| Molecular Weight | 398.82 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 1-(4-chlorophenyl)-9-ethyl-2-(4,4,4-trifluoro-3-methylbutyl)purin-6-one |
| SMILES | CCn1cnc2c(=O)n(-c3ccc(Cl)cc3)c(CCC(C)C(F)(F)F)nc21 |
| InChI | InChI=1S/C18H18ClF3N4O/c1-3-25-10-23-15-16(25)24-14(9-4-11(2)18(20,21)22)26(17(15)27)13-7-5-12(19)6-8-13/h5-8,10-11H,3-4,9H2,1-2H3 |
| InChIKey | LNDQBLPPVMOVDF-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.82 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |