C20H21ClF2N4O — CID 69077555
1-(4-chlorophenyl)-2-[(4,4-difluorocyclohexyl)methyl]-9-ethylpurin-6-one (PubChem CID 69077555) has the molecular formula C20H21ClF2N4O and a molecular weight of 406.86 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-[(4,4-difluorocyclohexyl)methyl]-9-ethylpurin-6-one.
| Compound Name | 1-(4-chlorophenyl)-2-[(4,4-difluorocyclohexyl)methyl]-9-ethylpurin-6-one |
|---|---|
| PubChem CID | 69077555 |
| Molecular Formula | C20H21ClF2N4O |
| Molecular Weight | 406.86 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 1-(4-chlorophenyl)-2-[(4,4-difluorocyclohexyl)methyl]-9-ethylpurin-6-one |
| SMILES | CCn1cnc2c(=O)n(-c3ccc(Cl)cc3)c(CC3CCC(F)(F)CC3)nc21 |
| InChI | InChI=1S/C20H21ClF2N4O/c1-2-26-12-24-17-18(26)25-16(11-13-7-9-20(22,23)10-8-13)27(19(17)28)15-5-3-14(21)4-6-15/h3-6,12-13H,2,7-11H2,1H3 |
| InChIKey | ROVZNFURWNKGOX-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.86 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |