C16H10FN7O — CID 22348365
11-[(2-fluorophenyl)methyl]-4-(furan-2-yl)-3,4,5,7,9,10,12-heptazatricyclo[7.3.0.02,6]dodeca-1(12),2,5,7,10-pentaene (PubChem CID 22348365) has the molecular formula C16H10FN7O and a molecular weight of 335.30 g/mol. Its IUPAC name is 11-[(2-fluorophenyl)methyl]-4-(furan-2-yl)-3,4,5,7,9,10,12-heptazatricyclo[7.3.0.02,6]dodeca-1(12),2,5,7,10-pentaene.
| Compound Name | 11-[(2-fluorophenyl)methyl]-4-(furan-2-yl)-3,4,5,7,9,10,12-heptazatricyclo[7.3.0.02,6]dodeca-1(12),2,5,7,10-pentaene |
|---|---|
| PubChem CID | 22348365 |
| Molecular Formula | C16H10FN7O |
| Molecular Weight | 335.30 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 11-[(2-fluorophenyl)methyl]-4-(furan-2-yl)-3,4,5,7,9,10,12-heptazatricyclo[7.3.0.02,6]dodeca-1(12),2,5,7,10-pentaene |
| SMILES | Fc1ccccc1Cc1nc2c3nn(-c4ccco4)nc3ncn2n1 |
| InChI | InChI=1S/C16H10FN7O/c17-11-5-2-1-4-10(11)8-12-19-16-14-15(18-9-23(16)20-12)22-24(21-14)13-6-3-7-25-13/h1-7,9H,8H2 |
| InChIKey | PLCGDJAGORUFBV-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 86.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |