C15H14N6 — CID 140535355
2-N-benzyl-9-prop-2-ynylpurine-2,6-diamine (PubChem CID 140535355) has the molecular formula C15H14N6 and a molecular weight of 278.32 g/mol. Its IUPAC name is 2-N-benzyl-9-prop-2-ynylpurine-2,6-diamine.
| Compound Name | 2-N-benzyl-9-prop-2-ynylpurine-2,6-diamine |
|---|---|
| PubChem CID | 140535355 |
| Molecular Formula | C15H14N6 |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 2-N-benzyl-9-prop-2-ynylpurine-2,6-diamine |
| SMILES | C#CCn1cnc2c(N)nc(NCc3ccccc3)nc21 |
| InChI | InChI=1S/C15H14N6/c1-2-8-21-10-18-12-13(16)19-15(20-14(12)21)17-9-11-6-4-3-5-7-11/h1,3-7,10H,8-9H2,(H3,16,17,19,20) |
| InChIKey | ZNDISXCZYRQDHF-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|