C14H13N7S — CID 130246491
9-(1,3-benzothiazol-2-ylmethyl)-2-N-methylpurine-2,6-diamine (PubChem CID 130246491) has the molecular formula C14H13N7S and a molecular weight of 311.37 g/mol. Its IUPAC name is 9-(1,3-benzothiazol-2-ylmethyl)-2-N-methylpurine-2,6-diamine.
| Compound Name | 9-(1,3-benzothiazol-2-ylmethyl)-2-N-methylpurine-2,6-diamine |
|---|---|
| PubChem CID | 130246491 |
| Molecular Formula | C14H13N7S |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 9-(1,3-benzothiazol-2-ylmethyl)-2-N-methylpurine-2,6-diamine |
| SMILES | CNc1nc(N)c2ncn(Cc3nc4ccccc4s3)c2n1 |
| InChI | InChI=1S/C14H13N7S/c1-16-14-19-12(15)11-13(20-14)21(7-17-11)6-10-18-8-4-2-3-5-9(8)22-10/h2-5,7H,6H2,1H3,(H3,15,16,19,20) |
| InChIKey | KHHYGVOZTCJFOO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |