C13H14ClN7 — CID 66868049
9-(2-chloroethyl)-2-N-(pyridin-4-ylmethyl)purine-2,6-diamine (PubChem CID 66868049) has the molecular formula C13H14ClN7 and a molecular weight of 303.76 g/mol. Its IUPAC name is 9-(2-chloroethyl)-2-N-(pyridin-4-ylmethyl)purine-2,6-diamine.
| Compound Name | 9-(2-chloroethyl)-2-N-(pyridin-4-ylmethyl)purine-2,6-diamine |
|---|---|
| PubChem CID | 66868049 |
| Molecular Formula | C13H14ClN7 |
| Molecular Weight | 303.76 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 9-(2-chloroethyl)-2-N-(pyridin-4-ylmethyl)purine-2,6-diamine |
| SMILES | Nc1nc(NCc2ccncc2)nc2c1ncn2CCCl |
| InChI | InChI=1S/C13H14ClN7/c14-3-6-21-8-18-10-11(15)19-13(20-12(10)21)17-7-9-1-4-16-5-2-9/h1-2,4-5,8H,3,6-7H2,(H3,15,17,19,20) |
| InChIKey | VMRQPIPIPGDQBF-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.76 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|