C17H21N5O — CID 165433963
N-[2-(3,5-dimethylphenoxy)ethyl]-9-ethylpurin-6-amine (PubChem CID 165433963) has the molecular formula C17H21N5O and a molecular weight of 311.39 g/mol. Its IUPAC name is N-[2-(3,5-dimethylphenoxy)ethyl]-9-ethylpurin-6-amine.
| Compound Name | N-[2-(3,5-dimethylphenoxy)ethyl]-9-ethylpurin-6-amine |
|---|---|
| PubChem CID | 165433963 |
| Molecular Formula | C17H21N5O |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | N-[2-(3,5-dimethylphenoxy)ethyl]-9-ethylpurin-6-amine |
| SMILES | CCn1cnc2c(NCCOc3cc(C)cc(C)c3)ncnc21 |
| InChI | InChI=1S/C17H21N5O/c1-4-22-11-21-15-16(19-10-20-17(15)22)18-5-6-23-14-8-12(2)7-13(3)9-14/h7-11H,4-6H2,1-3H3,(H,18,19,20) |
| InChIKey | TUOQAYLRAWSIGO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|