C17H21N5O3 — CID 100667164
(1R)-1-(2,5-dimethoxyphenyl)-2-[(9-ethylpurin-6-yl)amino]ethanol (PubChem CID 100667164) has the molecular formula C17H21N5O3 and a molecular weight of 343.39 g/mol. Its IUPAC name is (1R)-1-(2,5-dimethoxyphenyl)-2-[(9-ethylpurin-6-yl)amino]ethanol.
| Compound Name | (1R)-1-(2,5-dimethoxyphenyl)-2-[(9-ethylpurin-6-yl)amino]ethanol |
|---|---|
| PubChem CID | 100667164 |
| Molecular Formula | C17H21N5O3 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | (1R)-1-(2,5-dimethoxyphenyl)-2-[(9-ethylpurin-6-yl)amino]ethanol |
| SMILES | CCn1cnc2c(NC[C@H](O)c3cc(OC)ccc3OC)ncnc21 |
| InChI | InChI=1S/C17H21N5O3/c1-4-22-10-21-15-16(19-9-20-17(15)22)18-8-13(23)12-7-11(24-2)5-6-14(12)25-3/h5-7,9-10,13,23H,4,8H2,1-3H3,(H,18,19,20)/t13-/m0/s1 |
| InChIKey | TYOAMCSUYAZBCU-ZDUSSCGKSA-N |
| XLogP | 2.01 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |