C13H14N6O — CID 7584473
3-ethyl-N-(3-methoxyphenyl)triazolo[4,5-d]pyrimidin-7-amine (PubChem CID 7584473) has the molecular formula C13H14N6O and a molecular weight of 270.30 g/mol. Its IUPAC name is 3-ethyl-N-(3-methoxyphenyl)triazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | 3-ethyl-N-(3-methoxyphenyl)triazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 7584473 |
| Molecular Formula | C13H14N6O |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 3-ethyl-N-(3-methoxyphenyl)triazolo[4,5-d]pyrimidin-7-amine |
| SMILES | CCn1nnc2c(Nc3cccc(OC)c3)ncnc21 |
| InChI | InChI=1S/C13H14N6O/c1-3-19-13-11(17-18-19)12(14-8-15-13)16-9-5-4-6-10(7-9)20-2/h4-8H,3H2,1-2H3,(H,14,15,16) |
| InChIKey | FPLLKVACNZNUDU-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |