C26H32N8O2 — CID 155806641
3-[2-(3,5-dimethoxyphenyl)ethyl]-N-[4-(4-ethylpiperazin-1-yl)phenyl]triazolo[4,5-d]pyrimidin-7-amine (PubChem CID 155806641) has the molecular formula C26H32N8O2 and a molecular weight of 488.60 g/mol. Its IUPAC name is 3-[2-(3,5-dimethoxyphenyl)ethyl]-N-[4-(4-ethylpiperazin-1-yl)phenyl]triazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | 3-[2-(3,5-dimethoxyphenyl)ethyl]-N-[4-(4-ethylpiperazin-1-yl)phenyl]triazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 155806641 |
| Molecular Formula | C26H32N8O2 |
| Molecular Weight | 488.60 g/mol |
| Exact Mass | 488.26 |
| IUPAC Name | 3-[2-(3,5-dimethoxyphenyl)ethyl]-N-[4-(4-ethylpiperazin-1-yl)phenyl]triazolo[4,5-d]pyrimidin-7-amine |
| SMILES | CCN1CCN(c2ccc(Nc3ncnc4c3nnn4CCc3cc(OC)cc(OC)c3)cc2)CC1 |
| InChI | InChI=1S/C26H32N8O2/c1-4-32-11-13-33(14-12-32)21-7-5-20(6-8-21)29-25-24-26(28-18-27-25)34(31-30-24)10-9-19-15-22(35-2)17-23(16-19)36-3/h5-8,15-18H,4,9-14H2,1-3H3,(H,27,28,29) |
| InChIKey | JUKHFKNLSMXZSZ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.60 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|