C27H31N5OS — CID 67327461
N-[4-(4-ethylpiperazin-1-yl)phenyl]-7-[2-(4-methoxyphenyl)ethyl]thieno[3,2-d]pyrimidin-4-amine (PubChem CID 67327461) has the molecular formula C27H31N5OS and a molecular weight of 473.65 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)phenyl]-7-[2-(4-methoxyphenyl)ethyl]thieno[3,2-d]pyrimidin-4-amine.
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)phenyl]-7-[2-(4-methoxyphenyl)ethyl]thieno[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 67327461 |
| Molecular Formula | C27H31N5OS |
| Molecular Weight | 473.65 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)phenyl]-7-[2-(4-methoxyphenyl)ethyl]thieno[3,2-d]pyrimidin-4-amine |
| SMILES | CCN1CCN(c2ccc(Nc3ncnc4c(CCc5ccc(OC)cc5)csc34)cc2)CC1 |
| InChI | InChI=1S/C27H31N5OS/c1-3-31-14-16-32(17-15-31)23-10-8-22(9-11-23)30-27-26-25(28-19-29-27)21(18-34-26)7-4-20-5-12-24(33-2)13-6-20/h5-6,8-13,18-19H,3-4,7,14-17H2,1-2H3,(H,28,29,30) |
| InChIKey | DJJFSTJIOKRFHB-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.65 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|