C30H30N6S — CID 67328636
7-[(E)-2-(4-aminonaphthalen-1-yl)ethenyl]-N-[4-(4-ethylpiperazin-1-yl)phenyl]thieno[3,2-d]pyrimidin-4-amine (PubChem CID 67328636) has the molecular formula C30H30N6S and a molecular weight of 506.68 g/mol. Its IUPAC name is 7-[(E)-2-(4-aminonaphthalen-1-yl)ethenyl]-N-[4-(4-ethylpiperazin-1-yl)phenyl]thieno[3,2-d]pyrimidin-4-amine.
| Compound Name | 7-[(E)-2-(4-aminonaphthalen-1-yl)ethenyl]-N-[4-(4-ethylpiperazin-1-yl)phenyl]thieno[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 67328636 |
| Molecular Formula | C30H30N6S |
| Molecular Weight | 506.68 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | 7-[(E)-2-(4-aminonaphthalen-1-yl)ethenyl]-N-[4-(4-ethylpiperazin-1-yl)phenyl]thieno[3,2-d]pyrimidin-4-amine |
| SMILES | CCN1CCN(c2ccc(Nc3ncnc4c(/C=C/c5ccc(N)c6ccccc56)csc34)cc2)CC1 |
| InChI | InChI=1S/C30H30N6S/c1-2-35-15-17-36(18-16-35)24-12-10-23(11-13-24)34-30-29-28(32-20-33-30)22(19-37-29)8-7-21-9-14-27(31)26-6-4-3-5-25(21)26/h3-14,19-20H,2,15-18,31H2,1H3,(H,32,33,34)/b8-7+ |
| InChIKey | UICBVRCXQIKZBU-BQYQJAHWSA-N |
| XLogP | 6.48 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.68 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|