C30H32N6OS — CID 53358181
N-cyclopropyl-4-[(E)-2-[4-[4-(4-ethylpiperazin-1-yl)anilino]thieno[3,2-d]pyrimidin-7-yl]ethenyl]benzamide (PubChem CID 53358181) has the molecular formula C30H32N6OS and a molecular weight of 524.69 g/mol. Its IUPAC name is N-cyclopropyl-4-[(E)-2-[4-[4-(4-ethylpiperazin-1-yl)anilino]thieno[3,2-d]pyrimidin-7-yl]ethenyl]benzamide.
| Compound Name | N-cyclopropyl-4-[(E)-2-[4-[4-(4-ethylpiperazin-1-yl)anilino]thieno[3,2-d]pyrimidin-7-yl]ethenyl]benzamide |
|---|---|
| PubChem CID | 53358181 |
| Molecular Formula | C30H32N6OS |
| Molecular Weight | 524.69 g/mol |
| Exact Mass | 524.24 |
| IUPAC Name | N-cyclopropyl-4-[(E)-2-[4-[4-(4-ethylpiperazin-1-yl)anilino]thieno[3,2-d]pyrimidin-7-yl]ethenyl]benzamide |
| SMILES | CCN1CCN(c2ccc(Nc3ncnc4c(/C=C/c5ccc(C(=O)NC6CC6)cc5)csc34)cc2)CC1 |
| InChI | InChI=1S/C30H32N6OS/c1-2-35-15-17-36(18-16-35)26-13-11-24(12-14-26)33-29-28-27(31-20-32-29)23(19-38-28)8-5-21-3-6-22(7-4-21)30(37)34-25-9-10-25/h3-8,11-14,19-20,25H,2,9-10,15-18H2,1H3,(H,34,37)(H,31,32,33)/b8-5+ |
| InChIKey | KNXAOLGXBFBWBW-VMPITWQZSA-N |
| XLogP | 5.64 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.69 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|