C12H11FN6 — CID 7584464
3-ethyl-N-(3-fluorophenyl)triazolo[4,5-d]pyrimidin-7-amine (PubChem CID 7584464) has the molecular formula C12H11FN6 and a molecular weight of 258.26 g/mol. Its IUPAC name is 3-ethyl-N-(3-fluorophenyl)triazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | 3-ethyl-N-(3-fluorophenyl)triazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 7584464 |
| Molecular Formula | C12H11FN6 |
| Molecular Weight | 258.26 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 3-ethyl-N-(3-fluorophenyl)triazolo[4,5-d]pyrimidin-7-amine |
| SMILES | CCn1nnc2c(Nc3cccc(F)c3)ncnc21 |
| InChI | InChI=1S/C12H11FN6/c1-2-19-12-10(17-18-19)11(14-7-15-12)16-9-5-3-4-8(13)6-9/h3-7H,2H2,1H3,(H,14,15,16) |
| InChIKey | ROJGPSQQDATPPR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.26 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |