C18H15Cl2FN2O — CID 174207218
6-chloro-3-(4-chloro-3-fluorophenyl)-1-(oxolan-2-ylmethyl)pyrrolo[2,3-b]pyridine (PubChem CID 174207218) has the molecular formula C18H15Cl2FN2O and a molecular weight of 365.24 g/mol. Its IUPAC name is 6-chloro-3-(4-chloro-3-fluorophenyl)-1-(oxolan-2-ylmethyl)pyrrolo[2,3-b]pyridine.
| Compound Name | 6-chloro-3-(4-chloro-3-fluorophenyl)-1-(oxolan-2-ylmethyl)pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 174207218 |
| Molecular Formula | C18H15Cl2FN2O |
| Molecular Weight | 365.24 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 6-chloro-3-(4-chloro-3-fluorophenyl)-1-(oxolan-2-ylmethyl)pyrrolo[2,3-b]pyridine |
| SMILES | Fc1cc(-c2cn(CC3CCCO3)c3nc(Cl)ccc23)ccc1Cl |
| InChI | InChI=1S/C18H15Cl2FN2O/c19-15-5-3-11(8-16(15)21)14-10-23(9-12-2-1-7-24-12)18-13(14)4-6-17(20)22-18/h3-6,8,10,12H,1-2,7,9H2 |
| InChIKey | CUZNRLSBMJLGNY-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.24 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|