C11H12ClN3O — CID 166090821
2-chloro-7-(oxolan-2-ylmethyl)pyrrolo[2,3-d]pyrimidine (PubChem CID 166090821) has the molecular formula C11H12ClN3O and a molecular weight of 237.69 g/mol. Its IUPAC name is 2-chloro-7-(oxolan-2-ylmethyl)pyrrolo[2,3-d]pyrimidine.
| Compound Name | 2-chloro-7-(oxolan-2-ylmethyl)pyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 166090821 |
| Molecular Formula | C11H12ClN3O |
| Molecular Weight | 237.69 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 2-chloro-7-(oxolan-2-ylmethyl)pyrrolo[2,3-d]pyrimidine |
| SMILES | Clc1ncc2ccn(CC3CCCO3)c2n1 |
| InChI | InChI=1S/C11H12ClN3O/c12-11-13-6-8-3-4-15(10(8)14-11)7-9-2-1-5-16-9/h3-4,6,9H,1-2,5,7H2 |
| InChIKey | XXHLWPNPHCLMDL-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.69 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |