C24H32N6O3 — CID 166090791
2-[2-(4-methylpiperazin-1-yl)-5-[[7-(oxolan-2-ylmethyl)pyrrolo[2,3-d]pyrimidin-2-yl]amino]phenoxy]ethanol (PubChem CID 166090791) has the molecular formula C24H32N6O3 and a molecular weight of 452.56 g/mol. Its IUPAC name is 2-[2-(4-methylpiperazin-1-yl)-5-[[7-(oxolan-2-ylmethyl)pyrrolo[2,3-d]pyrimidin-2-yl]amino]phenoxy]ethanol.
| Compound Name | 2-[2-(4-methylpiperazin-1-yl)-5-[[7-(oxolan-2-ylmethyl)pyrrolo[2,3-d]pyrimidin-2-yl]amino]phenoxy]ethanol |
|---|---|
| PubChem CID | 166090791 |
| Molecular Formula | C24H32N6O3 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | 2-[2-(4-methylpiperazin-1-yl)-5-[[7-(oxolan-2-ylmethyl)pyrrolo[2,3-d]pyrimidin-2-yl]amino]phenoxy]ethanol |
| SMILES | CN1CCN(c2ccc(Nc3ncc4ccn(CC5CCCO5)c4n3)cc2OCCO)CC1 |
| InChI | InChI=1S/C24H32N6O3/c1-28-8-10-29(11-9-28)21-5-4-19(15-22(21)33-14-12-31)26-24-25-16-18-6-7-30(23(18)27-24)17-20-3-2-13-32-20/h4-7,15-16,20,31H,2-3,8-14,17H2,1H3,(H,25,26,27) |
| InChIKey | GORLHMUTVPEQDS-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 87.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|