C21H29ClN6O2 — CID 162732612
[5-[[5-chloro-4-[[(2R)-oxolan-2-yl]methylamino]pyrimidin-2-yl]amino]-2-(4-methylpiperazin-1-yl)phenyl]methanol (PubChem CID 162732612) has the molecular formula C21H29ClN6O2 and a molecular weight of 432.96 g/mol. Its IUPAC name is [5-[[5-chloro-4-[[(2R)-oxolan-2-yl]methylamino]pyrimidin-2-yl]amino]-2-(4-methylpiperazin-1-yl)phenyl]methanol.
| Compound Name | [5-[[5-chloro-4-[[(2R)-oxolan-2-yl]methylamino]pyrimidin-2-yl]amino]-2-(4-methylpiperazin-1-yl)phenyl]methanol |
|---|---|
| PubChem CID | 162732612 |
| Molecular Formula | C21H29ClN6O2 |
| Molecular Weight | 432.96 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | [5-[[5-chloro-4-[[(2R)-oxolan-2-yl]methylamino]pyrimidin-2-yl]amino]-2-(4-methylpiperazin-1-yl)phenyl]methanol |
| SMILES | CN1CCN(c2ccc(Nc3ncc(Cl)c(NC[C@H]4CCCO4)n3)cc2CO)CC1 |
| InChI | InChI=1S/C21H29ClN6O2/c1-27-6-8-28(9-7-27)19-5-4-16(11-15(19)14-29)25-21-24-13-18(22)20(26-21)23-12-17-3-2-10-30-17/h4-5,11,13,17,29H,2-3,6-10,12,14H2,1H3,(H2,23,24,25,26)/t17-/m1/s1 |
| InChIKey | AOZFUJLMNJSVFK-QGZVFWFLSA-N |
| XLogP | 2.71 |
| TPSA | 85.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.96 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|