C22H29N5O2 — CID 109229049
N-[4-(4-methylpiperazin-1-yl)phenyl]-5-(oxolan-2-ylmethylamino)pyridine-3-carboxamide (PubChem CID 109229049) has the molecular formula C22H29N5O2 and a molecular weight of 395.51 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)phenyl]-5-(oxolan-2-ylmethylamino)pyridine-3-carboxamide.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-5-(oxolan-2-ylmethylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109229049 |
| Molecular Formula | C22H29N5O2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-5-(oxolan-2-ylmethylamino)pyridine-3-carboxamide |
| SMILES | CN1CCN(c2ccc(NC(=O)c3cncc(NCC4CCCO4)c3)cc2)CC1 |
| InChI | InChI=1S/C22H29N5O2/c1-26-8-10-27(11-9-26)20-6-4-18(5-7-20)25-22(28)17-13-19(15-23-14-17)24-16-21-3-2-12-29-21/h4-7,13-15,21,24H,2-3,8-12,16H2,1H3,(H,25,28) |
| InChIKey | UPWIKIXCLYACJE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|