C17H17Cl2N3O2 — CID 109229072
N-(3,5-dichlorophenyl)-5-(oxolan-2-ylmethylamino)pyridine-3-carboxamide (PubChem CID 109229072) has the molecular formula C17H17Cl2N3O2 and a molecular weight of 366.25 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-5-(oxolan-2-ylmethylamino)pyridine-3-carboxamide.
| Compound Name | N-(3,5-dichlorophenyl)-5-(oxolan-2-ylmethylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109229072 |
| Molecular Formula | C17H17Cl2N3O2 |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | N-(3,5-dichlorophenyl)-5-(oxolan-2-ylmethylamino)pyridine-3-carboxamide |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1)c1cncc(NCC2CCCO2)c1 |
| InChI | InChI=1S/C17H17Cl2N3O2/c18-12-5-13(19)7-14(6-12)22-17(23)11-4-15(9-20-8-11)21-10-16-2-1-3-24-16/h4-9,16,21H,1-3,10H2,(H,22,23) |
| InChIKey | RZZZAZAFRINTNK-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |