C23H23N3O3 — CID 109229065
5-(oxolan-2-ylmethylamino)-N-(2-phenoxyphenyl)pyridine-3-carboxamide (PubChem CID 109229065) has the molecular formula C23H23N3O3 and a molecular weight of 389.46 g/mol. Its IUPAC name is 5-(oxolan-2-ylmethylamino)-N-(2-phenoxyphenyl)pyridine-3-carboxamide.
| Compound Name | 5-(oxolan-2-ylmethylamino)-N-(2-phenoxyphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109229065 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 5-(oxolan-2-ylmethylamino)-N-(2-phenoxyphenyl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1Oc1ccccc1)c1cncc(NCC2CCCO2)c1 |
| InChI | InChI=1S/C23H23N3O3/c27-23(17-13-18(15-24-14-17)25-16-20-9-6-12-28-20)26-21-10-4-5-11-22(21)29-19-7-2-1-3-8-19/h1-5,7-8,10-11,13-15,20,25H,6,9,12,16H2,(H,26,27) |
| InChIKey | FAMXZADLWHHDGK-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |