C26H27N3O4 — CID 41210911
N-[[(2S)-oxolan-2-yl]methyl]-2-[[2-oxo-2-(2-phenoxyanilino)ethyl]amino]benzamide (PubChem CID 41210911) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is N-[[(2S)-oxolan-2-yl]methyl]-2-[[2-oxo-2-(2-phenoxyanilino)ethyl]amino]benzamide.
| Compound Name | N-[[(2S)-oxolan-2-yl]methyl]-2-[[2-oxo-2-(2-phenoxyanilino)ethyl]amino]benzamide |
|---|---|
| PubChem CID | 41210911 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | N-[[(2S)-oxolan-2-yl]methyl]-2-[[2-oxo-2-(2-phenoxyanilino)ethyl]amino]benzamide |
| SMILES | O=C(CNc1ccccc1C(=O)NC[C@@H]1CCCO1)Nc1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C26H27N3O4/c30-25(29-23-14-6-7-15-24(23)33-19-9-2-1-3-10-19)18-27-22-13-5-4-12-21(22)26(31)28-17-20-11-8-16-32-20/h1-7,9-10,12-15,20,27H,8,11,16-18H2,(H,28,31)(H,29,30)/t20-/m0/s1 |
| InChIKey | JAYCGFRLGCIBAH-FQEVSTJZSA-N |
| XLogP | 4.44 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |