C24H27N7O3 — CID 66659528
5-[[2-[3-(hydroxymethyl)-4-(4-methylpiperazin-1-yl)anilino]-5-methylpyrimidin-4-yl]amino]-3H-1,3-benzoxazol-2-one (PubChem CID 66659528) has the molecular formula C24H27N7O3 and a molecular weight of 461.53 g/mol. Its IUPAC name is 5-[[2-[3-(hydroxymethyl)-4-(4-methylpiperazin-1-yl)anilino]-5-methylpyrimidin-4-yl]amino]-3H-1,3-benzoxazol-2-one.
| Compound Name | 5-[[2-[3-(hydroxymethyl)-4-(4-methylpiperazin-1-yl)anilino]-5-methylpyrimidin-4-yl]amino]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 66659528 |
| Molecular Formula | C24H27N7O3 |
| Molecular Weight | 461.53 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | 5-[[2-[3-(hydroxymethyl)-4-(4-methylpiperazin-1-yl)anilino]-5-methylpyrimidin-4-yl]amino]-3H-1,3-benzoxazol-2-one |
| SMILES | Cc1cnc(Nc2ccc(N3CCN(C)CC3)c(CO)c2)nc1Nc1ccc2oc(=O)[nH]c2c1 |
| InChI | InChI=1S/C24H27N7O3/c1-15-13-25-23(29-22(15)26-18-4-6-21-19(12-18)28-24(33)34-21)27-17-3-5-20(16(11-17)14-32)31-9-7-30(2)8-10-31/h3-6,11-13,32H,7-10,14H2,1-2H3,(H,28,33)(H2,25,26,27,29) |
| InChIKey | OUFIKVZDOJGXDL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.53 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|