C24H26N8O3 — CID 66659844
1-methyl-4-[4-[[5-methyl-4-[(2-oxo-3H-1,3-benzoxazol-5-yl)amino]pyrimidin-2-yl]amino]phenyl]piperazine-2-carboxamide (PubChem CID 66659844) has the molecular formula C24H26N8O3 and a molecular weight of 474.53 g/mol. Its IUPAC name is 1-methyl-4-[4-[[5-methyl-4-[(2-oxo-3H-1,3-benzoxazol-5-yl)amino]pyrimidin-2-yl]amino]phenyl]piperazine-2-carboxamide.
| Compound Name | 1-methyl-4-[4-[[5-methyl-4-[(2-oxo-3H-1,3-benzoxazol-5-yl)amino]pyrimidin-2-yl]amino]phenyl]piperazine-2-carboxamide |
|---|---|
| PubChem CID | 66659844 |
| Molecular Formula | C24H26N8O3 |
| Molecular Weight | 474.53 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 1-methyl-4-[4-[[5-methyl-4-[(2-oxo-3H-1,3-benzoxazol-5-yl)amino]pyrimidin-2-yl]amino]phenyl]piperazine-2-carboxamide |
| SMILES | Cc1cnc(Nc2ccc(N3CCN(C)C(C(N)=O)C3)cc2)nc1Nc1ccc2oc(=O)[nH]c2c1 |
| InChI | InChI=1S/C24H26N8O3/c1-14-12-26-23(30-22(14)27-16-5-8-20-18(11-16)29-24(34)35-20)28-15-3-6-17(7-4-15)32-10-9-31(2)19(13-32)21(25)33/h3-8,11-12,19H,9-10,13H2,1-2H3,(H2,25,33)(H,29,34)(H2,26,27,28,30) |
| InChIKey | UFKHCNBEKYDQHY-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 145.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.53 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|