C23H24FN7O2 — CID 66659694
5-[[2-[4-(3-fluoro-4-methylpiperazin-1-yl)anilino]-5-methylpyrimidin-4-yl]amino]-3H-1,3-benzoxazol-2-one (PubChem CID 66659694) has the molecular formula C23H24FN7O2 and a molecular weight of 449.49 g/mol. Its IUPAC name is 5-[[2-[4-(3-fluoro-4-methylpiperazin-1-yl)anilino]-5-methylpyrimidin-4-yl]amino]-3H-1,3-benzoxazol-2-one.
| Compound Name | 5-[[2-[4-(3-fluoro-4-methylpiperazin-1-yl)anilino]-5-methylpyrimidin-4-yl]amino]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 66659694 |
| Molecular Formula | C23H24FN7O2 |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 5-[[2-[4-(3-fluoro-4-methylpiperazin-1-yl)anilino]-5-methylpyrimidin-4-yl]amino]-3H-1,3-benzoxazol-2-one |
| SMILES | Cc1cnc(Nc2ccc(N3CCN(C)C(F)C3)cc2)nc1Nc1ccc2oc(=O)[nH]c2c1 |
| InChI | InChI=1S/C23H24FN7O2/c1-14-12-25-22(29-21(14)26-16-5-8-19-18(11-16)28-23(32)33-19)27-15-3-6-17(7-4-15)31-10-9-30(2)20(24)13-31/h3-8,11-12,20H,9-10,13H2,1-2H3,(H,28,32)(H2,25,26,27,29) |
| InChIKey | HMVOUPIHPIADOE-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|