C14H11ClFN5 — CID 154829347
N-(3-chloro-4-fluorophenyl)-9-cyclopropylpurin-6-amine (PubChem CID 154829347) has the molecular formula C14H11ClFN5 and a molecular weight of 303.73 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-9-cyclopropylpurin-6-amine.
| Compound Name | N-(3-chloro-4-fluorophenyl)-9-cyclopropylpurin-6-amine |
|---|---|
| PubChem CID | 154829347 |
| Molecular Formula | C14H11ClFN5 |
| Molecular Weight | 303.73 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-9-cyclopropylpurin-6-amine |
| SMILES | Fc1ccc(Nc2ncnc3c2ncn3C2CC2)cc1Cl |
| InChI | InChI=1S/C14H11ClFN5/c15-10-5-8(1-4-11(10)16)20-13-12-14(18-6-17-13)21(7-19-12)9-2-3-9/h1,4-7,9H,2-3H2,(H,17,18,20) |
| InChIKey | DFPDJQPKFTVZBY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.73 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |