C19H18ClFN4OS — CID 175053931
1-azabicyclo[2.1.0]pentane;4-(3-chloro-4-fluoroanilino)-7-methoxyquinazoline-6-thiol (PubChem CID 175053931) has the molecular formula C19H18ClFN4OS and a molecular weight of 404.90 g/mol. Its IUPAC name is 1-azabicyclo[2.1.0]pentane;4-(3-chloro-4-fluoroanilino)-7-methoxyquinazoline-6-thiol.
| Compound Name | 1-azabicyclo[2.1.0]pentane;4-(3-chloro-4-fluoroanilino)-7-methoxyquinazoline-6-thiol |
|---|---|
| PubChem CID | 175053931 |
| Molecular Formula | C19H18ClFN4OS |
| Molecular Weight | 404.90 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 1-azabicyclo[2.1.0]pentane;4-(3-chloro-4-fluoroanilino)-7-methoxyquinazoline-6-thiol |
| SMILES | C1CN2CC12.COc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1S |
| InChI | InChI=1S/C15H11ClFN3OS.C4H7N/c1-21-13-6-12-9(5-14(13)22)15(19-7-18-12)20-8-2-3-11(17)10(16)4-8;1-2-5-3-4(1)5/h2-7,22H,1H3,(H,18,19,20);4H,1-3H2 |
| InChIKey | ZIYFUNGMPARTOA-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 50.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.90 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|