C19H35N5OSi — CID 67145030
9-[(2S,3R)-2-[tert-butyl(dimethyl)silyl]oxyoctan-3-yl]purin-6-amine (PubChem CID 67145030) has the molecular formula C19H35N5OSi and a molecular weight of 377.61 g/mol. Its IUPAC name is 9-[(2S,3R)-2-[tert-butyl(dimethyl)silyl]oxyoctan-3-yl]purin-6-amine.
| Compound Name | 9-[(2S,3R)-2-[tert-butyl(dimethyl)silyl]oxyoctan-3-yl]purin-6-amine |
|---|---|
| PubChem CID | 67145030 |
| Molecular Formula | C19H35N5OSi |
| Molecular Weight | 377.61 g/mol |
| Exact Mass | 377.26 |
| IUPAC Name | 9-[(2S,3R)-2-[tert-butyl(dimethyl)silyl]oxyoctan-3-yl]purin-6-amine |
| SMILES | CCCCC[C@H]([C@H](C)O[Si](C)(C)C(C)(C)C)n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C19H35N5OSi/c1-8-9-10-11-15(14(2)25-26(6,7)19(3,4)5)24-13-23-16-17(20)21-12-22-18(16)24/h12-15H,8-11H2,1-7H3,(H2,20,21,22)/t14-,15+/m0/s1 |
| InChIKey | FMVVNXCCGQZOKT-LSDHHAIUSA-N |
| XLogP | 4.94 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.61 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|