C11H17N5O — CID 67145035
(2S,3S)-3-(6-aminopurin-9-yl)hexan-2-ol (PubChem CID 67145035) has the molecular formula C11H17N5O and a molecular weight of 235.29 g/mol. Its IUPAC name is (2S,3S)-3-(6-aminopurin-9-yl)hexan-2-ol.
| Compound Name | (2S,3S)-3-(6-aminopurin-9-yl)hexan-2-ol |
|---|---|
| PubChem CID | 67145035 |
| Molecular Formula | C11H17N5O |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | (2S,3S)-3-(6-aminopurin-9-yl)hexan-2-ol |
| SMILES | CCC[C@@H]([C@H](C)O)n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C11H17N5O/c1-3-4-8(7(2)17)16-6-15-9-10(12)13-5-14-11(9)16/h5-8,17H,3-4H2,1-2H3,(H2,12,13,14)/t7-,8-/m0/s1 |
| InChIKey | FPLMMSKPVLQAMG-YUMQZZPRSA-N |
| XLogP | 1.13 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |