C11H16ClN5O3 — CID 121245886
(1R,2S)-1-(6-aminopurin-9-yl)-1-[(2S)-1-chloro-3-hydroxypropan-2-yl]oxypropan-2-ol (PubChem CID 121245886) has the molecular formula C11H16ClN5O3 and a molecular weight of 301.73 g/mol. Its IUPAC name is (1R,2S)-1-(6-aminopurin-9-yl)-1-[(2S)-1-chloro-3-hydroxypropan-2-yl]oxypropan-2-ol.
| Compound Name | (1R,2S)-1-(6-aminopurin-9-yl)-1-[(2S)-1-chloro-3-hydroxypropan-2-yl]oxypropan-2-ol |
|---|---|
| PubChem CID | 121245886 |
| Molecular Formula | C11H16ClN5O3 |
| Molecular Weight | 301.73 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | (1R,2S)-1-(6-aminopurin-9-yl)-1-[(2S)-1-chloro-3-hydroxypropan-2-yl]oxypropan-2-ol |
| SMILES | C[C@H](O)[C@@H](O[C@@H](CO)CCl)n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C11H16ClN5O3/c1-6(19)11(20-7(2-12)3-18)17-5-16-8-9(13)14-4-15-10(8)17/h4-7,11,18-19H,2-3H2,1H3,(H2,13,14,15)/t6-,7+,11+/m0/s1 |
| InChIKey | RIXUXZAITLNDAW-MVKOHCKWSA-N |
| XLogP | -0.10 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.73 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|